
CAS 1203661-53-3
:4,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-1H-indazol-4-amine
Description:
4,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a trifluoromethyl group on the phenyl ring significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the indazole structure, which contributes to its saturation and stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions with biological targets can be influenced by the trifluoromethyl group, which is known to enhance binding affinity in some cases. Additionally, the amine functional group can participate in hydrogen bonding, further influencing its solubility and reactivity. Overall, this compound's unique structural features suggest potential applications in drug development and research.
Formula:C14H14F3N3
InChI:InChI=1S/C14H14F3N3/c15-14(16,17)9-3-1-4-10(7-9)20-13-6-2-5-12(18)11(13)8-19-20/h1,3-4,7-8,12H,2,5-6,18H2
InChI key:InChIKey=LRTHPBKGLBFENV-UHFFFAOYSA-N
SMILES:NC1C2=C(N(N=C2)C3=CC(C(F)(F)F)=CC=C3)CCC1
Synonyms:- 1-[3-(Trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-1H-indazol-4-amine
- 1-[3-(Trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindazol-4-amine
- 4,5,6,7-Tetrahydro-1-[3-(trifluoromethyl)phenyl]-1H-indazol-4-amine
- 1H-Indazol-4-amine, 4,5,6,7-tetrahydro-1-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.