CAS 1203661-57-7
:4,5,6,7-Tetrahydro-1-(4-methoxyphenyl)-1H-indazol-4-amine
Description:
4,5,6,7-Tetrahydro-1-(4-methoxyphenyl)-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturated nature. The substitution of a 4-methoxyphenyl group enhances its potential for biological activity, as methoxy groups can influence solubility and reactivity. The amine functional group at the 4-position of the indazole ring suggests potential for hydrogen bonding and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on its molecular conformation and the presence of other functional groups. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C14H17N3O
InChI:InChI=1S/C14H17N3O/c1-18-11-7-5-10(6-8-11)17-14-4-2-3-13(15)12(14)9-16-17/h5-9,13H,2-4,15H2,1H3
InChI key:InChIKey=AHVNFUAAVVNUGD-UHFFFAOYSA-N
SMILES:NC1C2=C(N(N=C2)C3=CC=C(OC)C=C3)CCC1
Synonyms:- 1H-Indazol-4-amine, 4,5,6,7-tetrahydro-1-(4-methoxyphenyl)-
- 4,5,6,7-Tetrahydro-1-(4-methoxyphenyl)-1H-indazol-4-amine
- 1-(4-Methoxyphenyl)-4,5,6,7-tetrahydroindazol-4-amine
- 1-(4-Methoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.