CAS 1203661-58-8

1H-Indazol-4-amine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro-

Description:

1H-Indazol-4-amine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro- is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 4-amino group and a 4-fluorophenyl substituent contributes to its potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including those typical of amines and heterocycles. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological interactions. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₃H₁₄FN₃

InChI: InChI=1S/C13H14FN3/c14-9-4-6-10(7-5-9)17-13-3-1-2-12(15)11(13)8-16-17/h4-8,12H,1-3,15H2

InChI key: InChIKey=HVSJXEBSVMLFAW-UHFFFAOYSA-N

SMILES: NC1C2=C(N(N=C2)C3=CC=C(F)C=C3)CCC1

Synonyms:

• 1-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine
• 1H-Indazol-4-amine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro-
• 1-(4-Fluorophenyl)-4,5,6,7-tetrahydroindazol-4-amine