CymitQuimica logo

CAS 1203661-59-9

:

1H-Indazol-4-amine, 1-(4-bromophenyl)-4,5,6,7-tetrahydro-

Description:
1H-Indazol-4-amine, 1-(4-bromophenyl)-4,5,6,7-tetrahydro- is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 4-bromophenyl group indicates that there is a bromine substituent on a phenyl ring attached to the indazole structure, which can influence the compound's reactivity and biological activity. The tetrahydro configuration suggests that the compound has a saturated ring system, contributing to its overall stability and potentially affecting its solubility and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular structure and the presence of functional groups. As with many organic compounds, it is essential to handle it with care, considering safety and environmental regulations.
Formula:C13H14BrN3
InChI:InChI=1S/C13H14BrN3/c14-9-4-6-10(7-5-9)17-13-3-1-2-12(15)11(13)8-16-17/h4-8,12H,1-3,15H2
InChI key:InChIKey=WCTJMDVTJWXUTI-UHFFFAOYSA-N
SMILES:NC1C2=C(N(N=C2)C3=CC=C(Br)C=C3)CCC1
Synonyms:
  • 1H-Indazol-4-amine, 1-(4-bromophenyl)-4,5,6,7-tetrahydro-
  • 1-(4-Bromophenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.