CAS 120368-15-2

[2-(2-methylallyloxy)phenyl]methanol

Description:

[2-(2-methylallyloxy)phenyl]methanol, with the CAS number 120368-15-2, is an organic compound characterized by its phenolic structure, which includes a methanol group and an ether linkage to a 2-methylallyl group. This compound typically exhibits properties associated with phenols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The presence of the 2-methylallyloxy substituent can influence its chemical behavior, potentially enhancing its reactivity in various organic reactions, including nucleophilic substitutions and polymerization processes. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry and materials science. Its molecular structure suggests that it could participate in hydrogen bonding, affecting its physical properties like boiling and melting points. Overall, [2-(2-methylallyloxy)phenyl]methanol is a versatile compound with applications in various fields, including pharmaceuticals and polymer chemistry.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-9(2)8-13-11-6-4-3-5-10(11)7-12/h3-6,12H,1,7-8H2,2H3

SMILES: C=C(C)COc1ccccc1CO

{2-[(2-methyl-2-propen-1-yl)oxy]phenyl}methanol

CAS: 120368-15-2

Formula: C₁₁H₁₄O₂

Purity: 95.0%

Molecular weight: 178.231

Ref: 10-F315937