CymitQuimica logo

CAS 1203680-98-1

:

B-(3′,4-Dihexyl[2,2′-bithiophen]-5-yl)boronic acid

Description:
B-(3′,4-Dihexyl[2,2′-bithiophen]-5-yl)boronic acid is an organoboron compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various organic synthesis and materials science applications. The presence of the bithiophene moiety contributes to its electronic properties, enhancing its potential use in organic electronics, such as organic photovoltaics and field-effect transistors. The hexyl substituents on the bithiophene structure increase solubility in organic solvents, facilitating processing and integration into devices. This compound may exhibit interesting photophysical properties, including light absorption and emission characteristics, due to the conjugated system formed by the bithiophene. Additionally, its boronic acid group allows for participation in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Overall, B-(3′,4-Dihexyl[2,2′-bithiophen]-5-yl)boronic acid is a versatile compound with significant implications in advanced materials and organic synthesis.
Formula:C20H31BO2S2
InChI:InChI=1S/C20H31BO2S2/c1-3-5-7-9-11-16-13-14-24-19(16)18-15-17(12-10-8-6-4-2)20(25-18)21(22)23/h13-15,22-23H,3-12H2,1-2H3
InChI key:InChIKey=NBPCHZKDYOWISG-UHFFFAOYSA-N
SMILES:C(CCCCC)C1=C(SC=C1)C2=CC(CCCCCC)=C(B(O)O)S2
Synonyms:
  • 3′,4-Dihexyl-2,2′-bithiophen-5-ylboronic acid
  • B-(3′,4-Dihexyl[2,2′-bithiophen]-5-yl)boronic acid
  • Boronic acid, B-(3′,4-dihexyl[2,2′-bithiophen]-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.