CAS 1203681-44-0
:7-Bromo-2-methyl-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one
Description:
7-Bromo-2-methyl-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine moiety. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. The methyl group at the 2-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit various pharmacological properties, making it of interest in drug discovery and development. Its oxazinone functional group suggests potential for tautomerism, which can affect its chemical behavior and interactions. Additionally, the compound's structure may allow for various substitution reactions, making it versatile for further chemical modifications. Overall, 7-Bromo-2-methyl-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one is a complex molecule with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C8H7BrN2O2
InChI:InChI=1S/C8H7BrN2O2/c1-4-8(12)11-7-6(13-4)2-5(9)3-10-7/h2-4H,1H3,(H,10,11,12)
InChI key:InChIKey=CASUXPNWWZGEGF-UHFFFAOYSA-N
SMILES:CC1OC=2C(NC1=O)=NC=C(Br)C2
Synonyms:- 2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 7-bromo-2-methyl-
- 7-Bromo-2-methyl-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one
- 7-Bromo-2-methyl-4H-pyrido[3,2-b][1,4]oxazin-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.