CAS 1203681-45-1
:2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine
Description:
2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a pyridine moiety. The presence of the 2,6-dichlorophenyl group contributes to its chemical stability and influences its reactivity. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, such as potential electron-withdrawing characteristics due to the chlorine substituents. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The thiazole and pyridine rings can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which can be exploited in synthetic chemistry. Additionally, its solubility and stability in different solvents can vary, impacting its application in various fields, including medicinal chemistry and materials science. Overall, 2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine is a compound of significant interest due to its structural complexity and potential applications.
Formula:C12H6Cl2N2S
InChI:InChI=1S/C12H6Cl2N2S/c13-7-2-1-3-8(14)11(7)12-16-9-4-5-15-6-10(9)17-12/h1-6H
InChI key:InChIKey=WYEYRTQOAPZITC-UHFFFAOYSA-N
SMILES:ClC1=C(C2=NC=3C(S2)=CN=CC3)C(Cl)=CC=C1
Synonyms:- Thiazolo[5,4-c]pyridine, 2-(2,6-dichlorophenyl)-
- 2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine
- 2-(2,6-Dichlorophenyl)-[1,3]thiazolo[5,4-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine
CAS:<p>2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine</p>Molecular weight:281.16g/mol

