CymitQuimica logo

CAS 1203682-73-8

:

Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-isoquinolinecarboxylate

Description:
Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-isoquinolinecarboxylate is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and it includes a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of methyl groups enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. As a derivative of isoquinoline, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's specific properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Overall, Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-isoquinolinecarboxylate represents a unique structure that may have implications in various fields, including drug development and organic synthesis.
Formula:C13H17NO2
InChI:InChI=1S/C13H17NO2/c1-13(2)8-14-7-10-5-4-9(6-11(10)13)12(15)16-3/h4-6,14H,7-8H2,1-3H3
InChI key:InChIKey=ULHZBWVANZNSPH-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=CC=C(C(OC)=O)C2)CNC1
Synonyms:
  • 6-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-4,4-dimethyl-, methyl ester
  • Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-isoquinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.