CymitQuimica logo

CAS 1203683-05-9

:

2′,3′-Dihydro-7′-(trifluoromethyl)spiro[cyclopropane-1,4′(1′H)-isoquinoline]

Description:
2′,3′-Dihydro-7′-(trifluoromethyl)spiro[cyclopropane-1,4′(1′H)-isoquinoline] is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopropane moiety with an isoquinoline framework. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dihydro form indicates the saturation of certain double bonds, which can affect the compound's reactivity and stability. This compound is likely to exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in various biological pathways. Its structural complexity suggests potential applications in drug development, particularly in targeting specific receptors or enzymes. As with many organic compounds, its solubility, melting point, and reactivity would depend on the surrounding conditions and the presence of functional groups. Overall, 2′,3′-Dihydro-7′-(trifluoromethyl)spiro[cyclopropane-1,4′(1′H)-isoquinoline] represents a fascinating area of study within organic and medicinal chemistry.
Formula:C12H12F3N
InChI:InChI=1S/C12H12F3N/c13-12(14,15)9-1-2-10-8(5-9)6-16-7-11(10)3-4-11/h1-2,5,16H,3-4,6-7H2
InChI key:InChIKey=NEDCDHNCIXGLQJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(C3(CC3)CNC2)=CC1
Synonyms:
  • 2′,3′-Dihydro-7′-(trifluoromethyl)spiro[cyclopropane-1,4′(1′H)-isoquinoline]
  • Spiro[cyclopropane-1,4′(1′H)-isoquinoline], 2′,3′-dihydro-7′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.