
CAS 1203683-18-4
:Spiro[cyclopropane-1,4′(1′H)-isoquinoline]-8′-carboxylic acid, 2′,3′-dihydro-, methyl ester, hydrochloride (1:1)
Description:
Spiro[cyclopropane-1,4′(1′H)-isoquinoline]-8′-carboxylic acid, 2′,3′-dihydro-, methyl ester, hydrochloride (1:1), identified by CAS number 1203683-18-4, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both cyclopropane and isoquinoline moieties. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility and reactivity. The hydrochloride form indicates the presence of a hydrochloric acid salt, which typically improves the compound's stability and solubility in aqueous environments. The dihydro configuration suggests partial saturation of the isoquinoline ring, which may influence its biological activity and chemical reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antitumor and antimicrobial activities. The specific stereochemistry and functional groups present in this compound can significantly affect its interactions with biological targets, making it a subject of interest for further research and development in drug discovery.
Formula:C13H15NO2·ClH
InChI:InChI=1S/C13H15NO2.ClH/c1-16-12(15)9-3-2-4-11-10(9)7-14-8-13(11)5-6-13;/h2-4,14H,5-8H2,1H3;1H
InChI key:InChIKey=JYABJPDUFJYLOQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(C3(CC3)CNC2)=CC=C1.Cl
Synonyms:- Spiro[cyclopropane-1,4′(1′H)-isoquinoline]-8′-carboxylic acid, 2′,3′-dihydro-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinoline]-8'-carboxylate hydrochloride
CAS:Formula:C13H16ClNO2Molecular weight:253.7246
