CymitQuimica logo

CAS 1203685-19-1

:

1,2,3,4-Tetrahydro-4,4-dimethyl-8-(trifluoromethyl)isoquinoline

Description:
1,2,3,4-Tetrahydro-4,4-dimethyl-8-(trifluoromethyl)isoquinoline is a bicyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a tetrahydro group indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system. The two methyl groups at the 4-position contribute to its steric bulk, while the trifluoromethyl group at the 8-position introduces significant electronegativity and lipophilicity, potentially influencing its reactivity and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its unique combination of functional groups can affect its solubility, stability, and interaction with biological targets. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a complex structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H14F3N
InChI:InChI=1S/C12H14F3N/c1-11(2)7-16-6-8-9(11)4-3-5-10(8)12(13,14)15/h3-5,16H,6-7H2,1-2H3
InChI key:InChIKey=ADVQKHHDRNBNEM-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=C(C(F)(F)F)C=CC2)CNC1
Synonyms:
  • Isoquinoline, 1,2,3,4-tetrahydro-4,4-dimethyl-8-(trifluoromethyl)-
  • 1,2,3,4-Tetrahydro-4,4-dimethyl-8-(trifluoromethyl)isoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.