
CAS 1203686-30-9
:8-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-4,4-dimethyl-, hydrochloride (1:1)
Description:
8-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-4,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. The presence of a carbonitrile group indicates that it contains a cyano functional group, contributing to its reactivity and potential applications in organic synthesis. The tetrahydro structure suggests that the compound has undergone partial hydrogenation, resulting in a saturated ring system, which can influence its physical and chemical properties, such as solubility and stability. The dimethyl substitution at the 4-position enhances steric hindrance and may affect the compound's biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could interact with biological targets. However, specific applications and biological activities would require further investigation and research.
Formula:C12H14N2·ClH
InChI:InChI=1S/C12H14N2.ClH/c1-12(2)8-14-7-10-9(6-13)4-3-5-11(10)12;/h3-5,14H,7-8H2,1-2H3;1H
InChI key:InChIKey=XQCSJBGHRWMNDQ-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=C(C#N)C=CC2)CNC1.Cl
Synonyms:- 8-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-4,4-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,4-Dimethyl-1,2,3,4-tetrahydroisoquinoline-8-carbonitrile hydrochloride
CAS:Formula:C12H15ClN2Molecular weight:222.7139
