
CAS 1203686-62-7
:1,2,3,4-Tetrahydro-4,4-dimethyl-5-isoquinolinecarbonitrile
Description:
1,2,3,4-Tetrahydro-4,4-dimethyl-5-isoquinolinecarbonitrile is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydroisoquinoline framework. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of dimethyl groups enhances its steric properties, which can influence its biological activity and interaction with other molecules. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in drug development. The molecular structure suggests potential for diverse interactions due to the nitrogen atoms in the isoquinoline ring, which can participate in hydrogen bonding and coordination with metal ions. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions, which are critical factors in its application in research and industry. Overall, 1,2,3,4-Tetrahydro-4,4-dimethyl-5-isoquinolinecarbonitrile represents a class of compounds that may hold significance in various chemical and pharmaceutical contexts.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c1-12(2)8-14-7-10-5-3-4-9(6-13)11(10)12/h3-5,14H,7-8H2,1-2H3
InChI key:InChIKey=NXLYCHGSVCJTRX-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(CNCC2(C)C)=CC=C1
Synonyms:- 1,2,3,4-Tetrahydro-4,4-dimethyl-5-isoquinolinecarbonitrile
- 5-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-4,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,4-Dimethyl-1,2,3,4-tetrahydroisoquinoline-5-carbonitrile
CAS:Formula:C12H14N2Molecular weight:186.2530
