CAS 1203686-89-8

8-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-4,4-dimethyl-, methyl ester, hydrochloride (1:1)

Description:

8-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-4,4-dimethyl-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a tetrahydro configuration, indicating the presence of a saturated ring system, and it includes a carboxylic acid moiety that has been esterified with a methyl group, resulting in a methyl ester. The hydrochloride form suggests that the compound is a salt, which enhances its solubility in water and may influence its biological activity. The presence of dimethyl groups indicates potential steric hindrance, which can affect the compound's reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to various pharmacological properties. Its specific applications and biological activities would depend on further studies and characterization. As with many isoquinoline derivatives, it may exhibit a range of activities, including potential use in drug development.

Formula: C₁₃H₁₇NO₂·ClH

InChI: InChI=1S/C13H17NO2.ClH/c1-13(2)8-14-7-10-9(12(15)16-3)5-4-6-11(10)13;/h4-6,14H,7-8H2,1-3H3;1H

InChI key: InChIKey=ZNVSEMFBAGPWBJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(C(C)(C)CNC2)=CC=C1.Cl

Synonyms:

• 8-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-4,4-dimethyl-, methyl ester, hydrochloride (1:1)

Methyl 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylate hydrochloride

CAS: 1203686-89-8

Formula: C₁₃H₁₈ClNO₂

Molecular weight: 255.7405

Ref: IN-DA0099SB