CymitQuimica logo

CAS 1203686-91-2

:

2′,3′-Dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline]-7′-carbonitrile

Description:
2′,3′-Dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline]-7′-carbonitrile is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopropane ring with an isoquinoline moiety. This compound features a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the spiro configuration often imparts interesting stereochemical properties, which can influence its interactions in biological systems. The isoquinoline part of the molecule is known for its presence in various natural products and pharmaceuticals, suggesting potential applications in medicinal chemistry. The compound's specific properties, such as solubility, melting point, and reactivity, would depend on its molecular interactions and the surrounding environment. As a relatively complex organic molecule, it may exhibit unique pharmacological activities, making it a subject of interest in drug discovery and development. Further studies would be necessary to elucidate its full range of characteristics and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c13-6-9-1-2-11-10(5-9)7-14-8-12(11)3-4-12/h1-2,5,14H,3-4,7-8H2
InChI key:InChIKey=NVNQKIFWTSNVLC-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(C3(CC3)CNC2)=CC1
Synonyms:
  • 2′,3′-Dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline]-7′-carbonitrile
  • Spiro[cyclopropane-1,4′(1′H)-isoquinoline]-7′-carbonitrile, 2′,3′-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.