CAS 1203796-58-0: 3-(4-Fluorophenyl)azetidine
Description:3-(4-Fluorophenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, which is attached to the azetidine. This compound is of interest in medicinal chemistry due to its potential biological activity and applications in drug development. The fluorine atom can influence the compound's lipophilicity, metabolic stability, and overall pharmacokinetic properties. Additionally, the azetidine ring can serve as a scaffold for further modifications, making it a versatile building block in organic synthesis. The compound's molecular structure contributes to its reactivity and interaction with biological targets, which can be explored in various therapeutic contexts. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample.
Formula:C9H10FN
InChI:InChI=1S/C9H10FN/c10-9-3-1-7(2-4-9)8-5-11-6-8/h1-4,8,11H,5-6H2
InChI key:InChIKey=BGOBDSPEJCPSDK-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=C1)C2CNC2
- Synonyms:
- 3-(4-Fluorophenyl)azetidine
- Azetidine, 3-(4-fluorophenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(4-Fluorophenyl)azetidine REF: TR-F595310CAS: 1203796-58-0 | - - - | 3,864.00 € | Tue 15 Apr 25 |
![]() | 3-(4-Fluorophenyl)azetidine REF: 3D-FF23473CAS: 1203796-58-0 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-(4-Fluorophenyl)azetidine
Controlled ProductRef: TR-F595310
500mg | 3,864.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-(4-Fluorophenyl)azetidine
Ref: 3D-FF23473
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |