CymitQuimica logo

CAS 1203796-99-9

:

3-(3,5-Difluorophenyl)azetidine

Description:
3-(3,5-Difluorophenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine substituents on a phenyl ring, specifically at the 3 and 5 positions, which can significantly influence its chemical properties, including reactivity and polarity. This compound may exhibit interesting biological activity due to the presence of the azetidine moiety, which is often found in various pharmaceuticals. The fluorine atoms can enhance lipophilicity and metabolic stability, making it a subject of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many fluorinated compounds, it may also exhibit unique physical properties, such as altered boiling and melting points compared to its non-fluorinated analogs. Overall, 3-(3,5-Difluorophenyl)azetidine represents a valuable structure for further research in both synthetic and medicinal chemistry.
Formula:C9H9F2N
InChI:InChI=1S/C9H9F2N/c10-8-1-6(2-9(11)3-8)7-4-12-5-7/h1-3,7,12H,4-5H2
InChI key:InChIKey=FNIOEHWSYCXSMF-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2CNC2
Synonyms:
  • 3-(3,5-Difluorophenyl)azetidine
  • Azetidine, 3-(3,5-difluorophenyl)-
Found 2 products.