CAS 1203797-48-1

Pyrrolidine, 3-(2,5-difluorophenyl)-

Description:

Pyrrolidine, 3-(2,5-difluorophenyl)- is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a 2,5-difluorophenyl group at the 3-position of the pyrrolidine ring introduces significant steric and electronic effects, influencing its reactivity and potential applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents, which makes it useful in various chemical reactions and synthesis processes. The difluorophenyl substituent can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of fluorine atoms can impart unique properties, such as increased metabolic stability and altered binding interactions with biological targets. As with many nitrogen-containing compounds, it may exhibit basicity and can participate in hydrogen bonding, influencing its behavior in different chemical environments.

Formula: C₁₀H₁₁F₂N

InChI: InChI=1S/C10H11F2N/c11-8-1-2-10(12)9(5-8)7-3-4-13-6-7/h1-2,5,7,13H,3-4,6H2

InChI key: InChIKey=NMBDXQPIMQZHQA-UHFFFAOYSA-N

SMILES: FC1=C(C=C(F)C=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(2,5-difluorophenyl)-
• 3-(2,5-Difluorophenyl)pyrrolidine