CymitQuimica logo

CAS 1203797-58-3

:

3-(2-Pyrrolidinyl)benzonitrile

Description:
3-(2-Pyrrolidinyl)benzonitrile, identified by its CAS number 1203797-58-3, is a chemical compound characterized by its structural features, which include a benzene ring substituted with a pyrrolidine group and a nitrile functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the nitrile group suggests that it may participate in nucleophilic addition reactions, while the pyrrolidine moiety can influence its interaction with biological systems, potentially affecting its pharmacological properties. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that can interact with biological targets. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be influenced by the balance of polar and nonpolar characteristics inherent in its molecular structure. Overall, 3-(2-Pyrrolidinyl)benzonitrile represents a versatile compound with potential applications in various fields, including drug discovery and organic synthesis.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c12-8-9-3-1-4-10(7-9)11-5-2-6-13-11/h1,3-4,7,11,13H,2,5-6H2
InChI key:InChIKey=PLLPVRDNESICJD-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1)C2CCCN2
Synonyms:
  • 3-(2-Pyrrolidinyl)benzonitrile
  • Benzonitrile, 3-(2-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.