CAS 1203798-88-2

Methyl 5-(4-methylphenyl)-3-piperidinecarboxylate

Description:

Methyl 5-(4-methylphenyl)-3-piperidinecarboxylate is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a 4-methylphenyl substituent indicates that there is a para-methyl group on the phenyl ring, which can influence the compound's electronic properties and steric hindrance. Typically, such compounds may exhibit moderate to high lipophilicity due to their hydrophobic aromatic and aliphatic components. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would be influenced by its molecular interactions and the presence of functional groups. Overall, Methyl 5-(4-methylphenyl)-3-piperidinecarboxylate is a compound of interest in organic synthesis and drug development.

Formula: C₁₄H₁₉NO₂

InChI: InChI=1S/C14H19NO2/c1-10-3-5-11(6-4-10)12-7-13(9-15-8-12)14(16)17-2/h3-6,12-13,15H,7-9H2,1-2H3

InChI key: InChIKey=BQJVGLDXABJDHR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CC(CNC1)C2=CC=C(C)C=C2

Synonyms:

• 3-Piperidinecarboxylic acid, 5-(4-methylphenyl)-, methyl ester
• Methyl 5-(4-methylphenyl)-3-piperidinecarboxylate