CAS 1203798-96-2

Methyl 2-(2-piperidinyl)benzoate

Description:

Methyl 2-(2-piperidinyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methyl alcohol. The structure features a benzoate moiety attached to a piperidine ring, contributing to its potential biological activity. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its lipophilic nature. It may exhibit properties such as moderate volatility and stability under standard conditions, although specific reactivity can depend on the presence of functional groups and environmental factors. Methyl 2-(2-piperidinyl)benzoate may be of interest in medicinal chemistry due to its structural similarity to various pharmacologically active compounds. Its synthesis often involves esterification reactions, and it may be utilized in research related to drug development or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-16-13(15)11-7-3-2-6-10(11)12-8-4-5-9-14-12/h2-3,6-7,12,14H,4-5,8-9H2,1H3

InChI key: InChIKey=IEQZQZOYCGACDC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C=CC=C1)C2CCCCN2

Synonyms:

• Benzoic acid, 2-(2-piperidinyl)-, methyl ester
• Methyl 2-(2-piperidinyl)benzoate