CAS 120383-85-9
:1-(Cyclopropylmethyl)-4-nitrobenzene
Description:
1-(Cyclopropylmethyl)-4-nitrobenzene, with the CAS number 120383-85-9, is an organic compound characterized by a nitro group (-NO2) attached to a benzene ring, which is further substituted with a cyclopropylmethyl group. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature. The presence of the nitro group contributes to its potential reactivity, making it a candidate for various chemical reactions, including electrophilic aromatic substitution. The cyclopropylmethyl group introduces strain due to the three-membered cyclopropane ring, which can influence the compound's stability and reactivity. Additionally, the compound may exhibit moderate solubility in organic solvents, while its solubility in water is expected to be low due to the hydrophobic nature of the aromatic and cyclopropyl groups. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous. Overall, 1-(Cyclopropylmethyl)-4-nitrobenzene is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c12-11(13)10-5-3-9(4-6-10)7-8-1-2-8/h3-6,8H,1-2,7H2
InChI key:InChIKey=GVEAGVFDOSZNJD-UHFFFAOYSA-N
SMILES:C(C1=CC=C(N(=O)=O)C=C1)C2CC2
Synonyms:- 1-(Cyclopropylmethyl)-4-nitrobenzene
- Benzene, 1-(cyclopropylmethyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
