
CAS 1203844-18-1
:B-[7-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indol-2-yl]boronic acid
Description:
B-[7-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indol-2-yl]boronic acid, with the CAS number 1203844-18-1, is a boronic acid derivative characterized by its unique structural features, including an indole moiety and a silyl ether group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, while the boronic acid functionality allows for participation in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds. Additionally, the compound may exhibit biological activity due to the indole structure, which is often associated with pharmacological properties. Overall, this compound represents a versatile building block in synthetic chemistry, particularly in the development of complex organic molecules and potential therapeutic agents.
Formula:C14H22BNO3Si
InChI:InChI=1S/C14H22BNO3Si/c1-14(2,3)20(4,5)19-11-8-6-7-10-9-12(15(17)18)16-13(10)11/h6-9,16-18H,1-5H3
InChI key:InChIKey=BZXORQAUAUUNRY-UHFFFAOYSA-N
SMILES:O([Si](C(C)(C)C)(C)C)C1=C2C(C=C(B(O)O)N2)=CC=C1
Synonyms:- Boronic acid, B-[7-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1H-indol-2-yl]-
- B-[7-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indol-2-yl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-(tert-Butyldimethylsilyloxy)-1h-indol-2-ylboronic acid
CAS:Formula:C14H22BNO3SiMolecular weight:291.2259
