CAS 1203898-15-0

Methyl 3-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]benzoate

Description:

Methyl 3-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]benzoate, identified by its CAS number 1203898-15-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoate moiety, an ethoxy group, and a piperazine ring substituted with a phenylmethyl group. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of aromatic and aliphatic components, which can influence its solubility in various solvents. The piperazine ring is known for its biological activity, often contributing to pharmacological effects, making this compound of interest in medicinal chemistry. Its potential applications may include roles in drug development, particularly in the context of central nervous system disorders, given the structural motifs that are often associated with neuroactive compounds. Additionally, the presence of the methyl ester functional group may affect its reactivity and stability, influencing its behavior in biological systems. Overall, this compound represents a significant example of the interplay between structure and function in organic chemistry.

Formula: C₂₁H₂₆N₂O₃

InChI: InChI=1S/C21H26N2O3/c1-25-21(24)19-8-5-9-20(16-19)26-15-14-22-10-12-23(13-11-22)17-18-6-3-2-4-7-18/h2-9,16H,10-15,17H2,1H3

InChI key: InChIKey=BYVGJIBTTHSUEB-UHFFFAOYSA-N

SMILES: C(N1CCN(CCOC2=CC(C(OC)=O)=CC=C2)CC1)C3=CC=CC=C3

Synonyms:

• Benzoic acid, 3-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]-, methyl ester
• Methyl 3-[2-[4-(phenylmethyl)-1-piperazinyl]ethoxy]benzoate