
CAS 1203898-18-3
:1-Thia-4,8-diazaspiro[4.5]decan-3-one, hydrochloride (1:1)
Description:
1-Thia-4,8-diazaspiro[4.5]decan-3-one, hydrochloride (1:1), identified by its CAS number 1203898-18-3, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within a bicyclic framework. This compound features a thiazolidine moiety and two nitrogen atoms that contribute to its diazacyclic nature. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the spiro structure often imparts interesting biological activities, potentially influencing its interaction with biological targets. Additionally, the compound's properties, such as melting point, solubility, and stability, can be affected by the hydrochloride salt form. Overall, 1-Thia-4,8-diazaspiro[4.5]decan-3-one, hydrochloride is of interest for its potential therapeutic applications, particularly in the development of novel pharmaceuticals. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C7H12N2OS·ClH
InChI:InChI=1S/C7H12N2OS.ClH/c10-6-5-11-7(9-6)1-3-8-4-2-7;/h8H,1-5H2,(H,9,10);1H
InChI key:InChIKey=XSSPUQBSLMXRMC-UHFFFAOYSA-N
SMILES:O=C1NC2(SC1)CCNCC2.Cl
Synonyms:- 1-Thia-4,8-diazaspiro[4.5]decan-3-one, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.