CymitQuimica logo

CAS 1203898-20-7

:

6-Chloro-1-hydroxy-2-phenyl-5-(trifluoromethyl)-1H-benzimidazole

Description:
6-Chloro-1-hydroxy-2-phenyl-5-(trifluoromethyl)-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a chloro group, a hydroxy group, a phenyl group, and a trifluoromethyl group. The presence of the chloro and trifluoromethyl substituents contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The hydroxy group may impart hydrogen-bonding capabilities, influencing its interactions in biological systems or chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many benzimidazole derivatives, it may also be investigated for its potential applications in pharmaceuticals, agrochemicals, or as a research tool in various chemical processes.
Formula:C14H8ClF3N2O
InChI:InChI=1S/C14H8ClF3N2O/c15-10-7-12-11(6-9(10)14(16,17)18)19-13(20(12)21)8-4-2-1-3-5-8/h1-7,21H
InChI key:InChIKey=DXHGWRBJOFUASE-UHFFFAOYSA-N
SMILES:ON1C=2C(N=C1C3=CC=CC=C3)=CC(C(F)(F)F)=C(Cl)C2
Synonyms:
  • 1H-Benzimidazole, 6-chloro-1-hydroxy-2-phenyl-5-(trifluoromethyl)-
  • 6-Chloro-1-hydroxy-2-phenyl-5-(trifluoromethyl)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.