CymitQuimica logo

CAS 120396-31-8

:

[(3aR,4R,6aS)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate

Description:
The chemical substance with the name "[(3aR,4R,6aS)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate" and CAS number "120396-31-8" is a complex organic compound characterized by its multi-ring structure and functional groups. It features a cyclopentafuran core, which contributes to its potential biological activity and stability. The presence of a dioxolane moiety indicates that it may exhibit unique solubility and reactivity properties, particularly in organic solvents. The heptyl chain enhances hydrophobic characteristics, which could influence its interaction with biological membranes. The phenylbenzoate group suggests potential applications in pharmaceuticals or as a chemical intermediate, possibly affecting its lipophilicity and binding affinity in biological systems. Overall, this compound's intricate structure and diverse functional groups may lead to interesting chemical behavior and potential applications in medicinal chemistry or materials science. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C32H40O6
InChI:InChI=1/C32H40O6/c1-2-3-4-5-9-17-32(35-19-20-36-32)18-16-26-27-21-30(33)37-29(27)22-28(26)38-31(34)25-14-12-24(13-15-25)23-10-7-6-8-11-23/h6-8,10-15,26-29H,2-5,9,16-22H2,1H3/t26-,27-,28?,29+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.