CymitQuimica logo

CAS 1204-32-6

:

Methyl 1-methyl-1H-indole-6-carboxylate

Description:
Methyl 1-methyl-1H-indole-6-carboxylate, with the CAS number 1204-32-6, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a methyl group and a carboxylate ester functional group, contributing to its chemical reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its aromatic properties and can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Methyl 1-methyl-1H-indole-6-carboxylate is soluble in organic solvents, which facilitates its use in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-12-6-5-8-3-4-9(7-10(8)12)11(13)14-2/h3-7H,1-2H3
InChI key:NMILWYUYIFMKTE-UHFFFAOYSA-N
SMILES:Cn1ccc2ccc(cc12)C(=O)OC
Synonyms:
  • 1H-Indole-6-carboxylic acid, 1-methyl-, methyl ester
Found 4 products.