CAS 1204-97-3

1-(2-methylphenyl)-3-prop-2-en-1-ylthiourea

Description:

1-(2-Methylphenyl)-3-prop-2-en-1-ylthiourea, with the CAS number 1204-97-3, is an organic compound characterized by its thiourea functional group, which features a sulfur atom bonded to a carbon atom that is also double-bonded to a nitrogen atom. This compound exhibits a unique structure due to the presence of a 2-methylphenyl group and a prop-2-en-1-yl substituent, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the thiourea moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as thioureas are known for their diverse biological activities. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Safety data should be consulted for handling, as compounds of this nature can pose health risks if not managed properly. Overall, its unique structural features make it a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₄N₂S

InChI: InChI=1/C11H14N2S/c1-3-8-12-11(14)13-10-7-5-4-6-9(10)2/h3-7H,1,8H2,2H3,(H2,12,13,14)

Synonyms:

• 1-Allyl-3-(2-methylphenyl)thiourea
• thiourea, N-(2-methylphenyl)-N'-2-propen-1-yl-