CAS 1204-99-5
:cycloserine diketopiperazine
Description:
Cycloserine diketopiperazine, with the CAS number 1204-99-5, is a cyclic compound that belongs to the class of diketopiperazines. It is characterized by its unique bicyclic structure, which consists of two peptide-like rings formed by the condensation of amino acids. This compound exhibits notable biological activity, particularly as an antibiotic, and has been studied for its potential use in treating tuberculosis and other bacterial infections. Cycloserine diketopiperazine is known for its ability to inhibit certain enzymes involved in bacterial cell wall synthesis, making it a valuable compound in medicinal chemistry. Additionally, it may exhibit neuroactive properties, contributing to its interest in pharmacological research. The compound is typically soluble in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, cycloserine diketopiperazine represents an important area of study in both synthetic and medicinal chemistry due to its diverse applications and biological significance.
Formula:C7H12N4O4
InChI:InChI=1/C4H6N2O2.C3H6N2O2/c7-3-4(8)6-2-1-5-3;4-2-1-7-5-3(2)6/h1-2H2,(H,5,7)(H,6,8);2H,1,4H2,(H,5,6)/t;2-/m.1/s1
SMILES:C1CNC(=O)C(=O)N1.C1[C@H](C(=NO1)O)N
Synonyms:- 3,6-Bis((aminooxy)methyl)-2,5-piperazinedione
- Nsc 119130
- 2,5-Piperazinedione, 3,6-bis((aminooxy)methyl)-
- 3,6-Bis[(Aminooxy)Methyl]Piperazine-2,5-Dione
- Cycloserine diketopiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Cycloserine Diketopiperazine (Mixture of Diastereomers)
CAS:Formula:C6H12N4O4Color and Shape:White To Off-White SolidMolecular weight:204.19Cycloserine Diketopiperazine
CAS:Controlled Product<p>Applications A Cycloserine dimer as potential impurity of drug Cycloserine (C988800).<br>References Perez-Sala, D., et al.: Biochem. Pharmacol., 38,1037 (1989),<br></p>Formula:C6H12N4O4Color and Shape:NeatMolecular weight:204.18



