CAS 120408-07-3
:disodium 2-({4-[2-(2-amino-4-oxo-1,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl]benzoyl}amino)pentanedioate
Description:
Disodium 2-({4-[2-(2-amino-4-oxo-1,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl]benzoyl}amino)pentanedioate, commonly referred to by its CAS number 120408-07-3, is a complex organic compound characterized by its dual sodium salt form, which enhances its solubility in aqueous solutions. This compound features a pentanedioate backbone, which contributes to its potential as a chelating agent or in biological applications. The presence of the hexahydropyrido[2,3-d]pyrimidine moiety indicates its potential biological activity, possibly as a pharmaceutical agent, given the structural motifs associated with various bioactive compounds. The amino and benzoyl groups suggest that it may participate in hydrogen bonding and other interactions, influencing its reactivity and stability. Overall, this compound's unique structure and functional groups may provide diverse applications in medicinal chemistry, particularly in drug design and development. However, specific properties such as melting point, solubility, and reactivity would require empirical data for precise characterization.
Formula:C21H26N5NaO6
InChI:InChI=1/C21H25N5O6.2Na/c22-21-25-17-14(19(30)26-21)9-12(10-23-17)2-1-11-3-5-13(6-4-11)18(29)24-15(20(31)32)7-8-16(27)28;;/h3-6,12,15H,1-2,7-10H2,(H,24,29)(H,27,28)(H,31,32)(H4,22,23,25,26,30);;/q;2*+1/p-2
Synonyms:- L-Glutamic acid,N-[4-[2-[(6R)-2-amino-3,4,5,6,7,8-hexahydro-4-oxopyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl]-,sodium salt (1:2)
- Lometrexol disodium
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lometrexol disodium
CAS:<p>Lometrexol disodium is an antifolate chemotherapeutic agent, which is a synthetic derivative of the naturally occurring compound folic acid. Its mechanism of action involves the inhibition of the enzyme glycinamide ribonucleotide formyltransferase (GARFT), which plays a critical role in the de novo purine biosynthesis pathway. By targeting GARFT, Lometrexol disodium effectively disrupts nucleotide synthesis, leading to impaired DNA replication and cell division, primarily affecting rapidly proliferating cancer cells.</p>Formula:C21H23N5Na2O6Purity:Min. 95%Molecular weight:487.4 g/molLometrexol disodium
CAS:<p>Lometrexol disodium: Inhibits hSHMT1/2 and GARFT, anticancer by blocking purine synthesis, induces apoptosis and cell cycle arrest.</p>Formula:C21H23N5Na2O6Color and Shape:SolidMolecular weight:487.424

