CAS 120418-62-4
:3-(4-CHLOROPHENYL)PYRROLIDINE
Description:
3-(4-Chlorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the para position of a phenyl ring, which is attached to the pyrrolidine. This compound is typically studied in the context of medicinal chemistry and pharmacology due to its potential biological activities. It may exhibit properties such as acting as a ligand for certain receptors or influencing neurotransmitter systems. The molecular structure contributes to its lipophilicity and potential for crossing biological membranes, which is crucial for its activity in biological systems. Additionally, the chlorophenyl substitution can affect the compound's reactivity and interaction with other molecules. As with many organic compounds, safety and handling precautions are important, and its use may be regulated depending on its application and potential effects on health and the environment.
Formula:C10H12ClN
InChI:InChI=1/C10H12ClN/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-4,9,12H,5-7H2
SMILES:c1cc(ccc1C1CCNC1)Cl
Synonyms:- Pyrrolidine, 3-(4-chlorophenyl)-
- 3-(4-Chlorophenyl)pyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(4-Chlorophenyl)pyrrolidine
CAS:3-(4-Chlorophenyl)pyrrolidine is a basic compound with two chiral centers. It has a skeletal structure of chains and rings. The stereogenic center is found at carbon 4, which has four possible arrangements: (1R,2S), (1S,2R), (1R,2R), and (1S,2S). 3-(4-Chlorophenyl)pyrrolidine is an organic compound that contains carbon chains and can be synthesized biologically. 3-(4-Chlorophenyl)pyrrolidine is a polyfunctional molecule that can function as an amino acid or as an intermediate in the synthesis of other compounds.Formula:C10H12ClNPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:181.66 g/mol3-(4-Chlorophenyl)pyrrolidine
CAS:Formula:C10H12ClNPurity:95.0%Color and Shape:SolidMolecular weight:181.66


