
CAS 1204234-49-0
:4-Bromo-2-[(trifluoromethyl)thio]pyridine
Description:
4-Bromo-2-[(trifluoromethyl)thio]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a trifluoromethylthio group at the 2-position significantly influences its chemical properties. This compound is typically a solid at room temperature and exhibits a distinct odor. It is known for its reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can enhance its electrophilic character. The bromine substituent can also participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in organic solvents and stability under standard conditions are important for its applications in synthesis and research. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C6H3BrF3NS
InChI:InChI=1S/C6H3BrF3NS/c7-4-1-2-11-5(3-4)12-6(8,9)10/h1-3H
InChI key:InChIKey=IAOFSJBDQNMOJB-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C1=CC(Br)=CC=N1
Synonyms:- 4-Bromo-2-[(trifluoromethyl)thio]pyridine
- Pyridine, 4-bromo-2-[(trifluoromethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.