CAS 1204234-54-7
:2,6-Difluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine
Description:
2,6-Difluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine is a fluorinated heterocyclic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with fluorine atoms, and at the 3 position with a pentafluoroethyl group. This structure imparts unique chemical properties, including increased lipophilicity and potential reactivity due to the presence of multiple fluorine atoms, which can influence the compound's behavior in various chemical environments. The fluorine substitutions enhance the compound's stability and resistance to degradation, making it useful in applications such as agrochemicals and pharmaceuticals. Additionally, the presence of the pyridine ring contributes to its aromatic character, which can affect its electronic properties and interactions with other molecules. The compound's CAS number, 1204234-54-7, allows for precise identification in chemical databases, facilitating research and development in fields that utilize fluorinated compounds. Overall, this substance exemplifies the significance of fluorination in modifying the properties of organic molecules.
Formula:C7H2F7N
InChI:InChI=1S/C7H2F7N/c8-4-2-1-3(5(9)15-4)6(10,11)7(12,13)14/h1-2H
InChI key:InChIKey=UAHBBQCGKWLYOU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=C(F)N=C(F)C=C1
Synonyms:- Pyridine, 2,6-difluoro-3-(1,1,2,2,2-pentafluoroethyl)-
- 2,6-Difluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
