
CAS 1204234-55-8
:6-Chloro-β,β-difluoro-2-pyridineethanamine
Description:
6-Chloro-β,β-difluoro-2-pyridineethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and two fluorine atoms on the ethylamine side chain. This compound is part of a class of molecules that may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of organic compounds, which can influence their pharmacokinetic properties. Additionally, the pyridine moiety contributes to the compound's ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The specific properties, such as solubility, melting point, and reactivity, would depend on the compound's interactions with solvents and other reagents. Overall, 6-Chloro-β,β-difluoro-2-pyridineethanamine represents a versatile structure with potential applications in medicinal chemistry and materials science.
Formula:C7H7ClF2N2
InChI:InChI=1S/C7H7ClF2N2/c8-6-3-1-2-5(12-6)7(9,10)4-11/h1-3H,4,11H2
InChI key:InChIKey=KNSRVAQUCJYJAF-UHFFFAOYSA-N
SMILES:C(CN)(F)(F)C=1N=C(Cl)C=CC1
Synonyms:- 6-Chloro-β,β-difluoro-2-pyridineethanamine
- 2-Pyridineethanamine, 6-chloro-β,β-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.