
CAS 1204234-63-8
:5-[(Trifluoromethyl)thio]-3-pyridinecarboxylic acid
Description:
5-[(Trifluoromethyl)thio]-3-pyridinecarboxylic acid is a chemical compound characterized by the presence of a pyridine ring substituted with a carboxylic acid group and a trifluoromethylthio group. The trifluoromethylthio moiety contributes to the compound's unique properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its trifluoromethyl group enhances its stability and can influence its reactivity, making it of interest in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The presence of the pyridine ring suggests potential interactions with biological targets, which may lead to interesting pharmacological properties. As with many fluorinated compounds, it may also exhibit unique environmental behavior, necessitating careful handling and consideration of its ecological impact. Overall, 5-[(Trifluoromethyl)thio]-3-pyridinecarboxylic acid is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H4F3NO2S
InChI:InChI=1S/C7H4F3NO2S/c8-7(9,10)14-5-1-4(6(12)13)2-11-3-5/h1-3H,(H,12,13)
InChI key:InChIKey=LBHFYDUVQBOFIQ-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C=1C=C(C(O)=O)C=NC1
Synonyms:- 5-[(Trifluoromethyl)thio]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-[(trifluoromethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.