
CAS 1204234-96-7
:3-Bromo-2-[(trifluoromethyl)thio]pyridine
Description:
3-Bromo-2-[(trifluoromethyl)thio]pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom and a trifluoromethylthio group. The molecular structure features a pyridine core, which is a six-membered aromatic ring containing one nitrogen atom. The bromine substitution typically enhances the compound's reactivity, making it useful in various chemical syntheses. The trifluoromethylthio group introduces significant electronegativity and lipophilicity, which can influence the compound's biological activity and solubility. This compound may exhibit interesting properties such as potential antimicrobial or herbicidal activity, owing to the presence of both the bromine and trifluoromethylthio functionalities. Additionally, its unique combination of substituents can lead to distinctive electronic properties, making it a subject of interest in medicinal chemistry and materials science. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C6H3BrF3NS
InChI:InChI=1S/C6H3BrF3NS/c7-4-2-1-3-11-5(4)12-6(8,9)10/h1-3H
InChI key:InChIKey=ATJIRTHKQVAGSM-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C1=C(Br)C=CC=N1
Synonyms:- 3-Bromo-2-[(trifluoromethyl)sulfanyl]pyridine
- Pyridine, 3-bromo-2-[(trifluoromethyl)thio]-
- 3-Bromo-2-[(trifluoromethyl)thio]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.