CymitQuimica logo

CAS 1204235-00-6

:

2-[(Trifluoromethyl)thio]-3-pyridinemethanamine

Description:
2-[(Trifluoromethyl)thio]-3-pyridinemethanamine, identified by its CAS number 1204235-00-6, is a chemical compound characterized by the presence of a pyridine ring substituted with a trifluoromethylthio group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential basicity due to the amine group. The trifluoromethylthio substituent can influence the compound's reactivity and polarity, often enhancing its lipophilicity and potentially affecting its biological activity. The presence of fluorine atoms generally increases the compound's stability and can alter its interaction with biological targets. Additionally, the compound may exhibit unique solubility characteristics, making it of interest in various chemical and pharmaceutical applications. Its structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. As with many pyridine derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions.
Formula:C7H7F3N2S
InChI:InChI=1S/C7H7F3N2S/c8-7(9,10)13-6-5(4-11)2-1-3-12-6/h1-3H,4,11H2
InChI key:InChIKey=BJELTRMIPOOSEW-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C1=C(CN)C=CC=N1
Synonyms:
  • 3-Pyridinemethanamine, 2-[(trifluoromethyl)thio]-
  • 2-[(Trifluoromethyl)thio]-3-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.