CymitQuimica logo

CAS 1204235-07-3

:

α,α-Difluoro-β-hydroxy-2-thiophenepropanoic acid

Description:
α,α-Difluoro-β-hydroxy-2-thiophenepropanoic acid is a chemical compound characterized by the presence of a thiophene ring, which contributes to its aromatic properties and potential reactivity. The molecule features two fluorine atoms attached to the alpha carbon, which can influence its electronic properties and reactivity, making it a subject of interest in medicinal chemistry and agrochemical applications. The β-hydroxy group introduces a hydroxyl functional group, enhancing its solubility in polar solvents and potentially allowing for hydrogen bonding interactions. This compound may exhibit unique biological activities due to its structural features, including the potential for enzyme inhibition or modulation. The presence of fluorine atoms often enhances metabolic stability and lipophilicity, which can be advantageous in drug design. Overall, α,α-Difluoro-β-hydroxy-2-thiophenepropanoic acid represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and materials science.
Formula:C7H6F2O3S
InChI:InChI=1S/C7H6F2O3S/c8-7(9,6(11)12)5(10)4-2-1-3-13-4/h1-3,5,10H,(H,11,12)
InChI key:InChIKey=DEQCOMAGLJGNSY-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=CS1)(C(O)=O)(F)F
Synonyms:
  • 2-Thiophenepropanoic acid, α,α-difluoro-β-hydroxy-
  • α,α-Difluoro-β-hydroxy-2-thiophenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.