CymitQuimica logo

CAS 1204235-19-7

:

3-[(Trifluoromethyl)thio]-2(1H)-pyridinone

Description:
3-[(Trifluoromethyl)thio]-2(1H)-pyridinone is a chemical compound characterized by its unique functional groups and structure. It features a pyridinone ring, which is a six-membered aromatic ring containing both nitrogen and a carbonyl group, contributing to its potential reactivity and biological activity. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and may influence its interaction with biological targets, while the thioether linkage (-S-) introduces sulfur into the molecular framework, potentially affecting its electronic properties and stability. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in various chemical environments can be influenced by these functional groups, leading to diverse reactivity patterns. As with many heterocyclic compounds, the synthesis and characterization of 3-[(Trifluoromethyl)thio]-2(1H)-pyridinone are crucial for understanding its potential uses in various fields, including agrochemicals and pharmaceuticals.
Formula:C6H4F3NOS
InChI:InChI=1S/C6H4F3NOS/c7-6(8,9)12-4-2-1-3-10-5(4)11/h1-3H,(H,10,11)
InChI key:InChIKey=HBKJUJHJXFXQDP-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)C=1C(=O)NC=CC1
Synonyms:
  • 2(1H)-Pyridinone, 3-[(trifluoromethyl)thio]-
  • 3-[(Trifluoromethyl)thio]-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.