CAS 1204235-23-3

5-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxylic acid

Description:

5-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxylic acid is a fluorinated organic compound characterized by its pyridine ring and a pentafluoroethyl substituent. The presence of the carboxylic acid functional group (-COOH) contributes to its acidic properties, making it soluble in polar solvents. The pentafluoroethyl group imparts unique electronic and steric properties, enhancing its potential applications in pharmaceuticals and agrochemicals. This compound is likely to exhibit high thermal stability and low volatility due to the strong C-F bonds associated with the fluorinated moiety. Additionally, the fluorine atoms can influence the compound's reactivity and interaction with biological systems, potentially affecting its bioavailability and pharmacokinetics. Its structural features suggest that it may participate in hydrogen bonding due to the carboxylic acid, while the fluorinated group may enhance lipophilicity. Overall, this compound represents a class of fluorinated pyridine derivatives that are of interest in various chemical research fields.

Formula: C₈H₄F₅NO₂

InChI: InChI=1S/C8H4F5NO2/c9-7(10,8(11,12)13)5-1-4(6(15)16)2-14-3-5/h1-3H,(H,15,16)

InChI key: InChIKey=FFALAWAHLYRURL-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C=1C=C(C(O)=O)C=NC1

Synonyms:

• 5-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(1,1,2,2,2-pentafluoroethyl)-