CymitQuimica logo

CAS 120427-94-3

:

2-(2-BROMOETHYL)-BETA-NITROSTYRENE

Description:
2-(2-Bromoethyl)-beta-nitrostyrene, with the CAS number 120427-94-3, is an organic compound characterized by its unique structure, which includes a nitro group and a bromoethyl substituent on a styrene backbone. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific formulation. It is known for its reactivity, particularly in electrophilic substitution reactions due to the presence of the nitro group, which is an electron-withdrawing group. The bromoethyl moiety can serve as a leaving group in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential toxicity. Proper storage conditions are essential to maintain its stability and prevent degradation. Overall, 2-(2-Bromoethyl)-beta-nitrostyrene is a valuable compound in synthetic organic chemistry with applications in various research fields.
Formula:C10H10BrNO2
InChI:InChI=1S/C10H10BrNO2/c11-7-5-9-3-1-2-4-10(9)6-8-12(13)14/h1-4,6,8H,5,7H2/b8-6+
InChI key:FCPRCFFVLWHIBS-SOFGYWHQSA-N
SMILES:C1=CC=C(C(=C1)CCBr)/C=C/[N+](=O)[O-]
Synonyms:
  • 2-(2-Bromoethyl)-B-Nitrostyrene
  • 1-(2-Bromoethyl)-2-(2-Nitroethenyl)-Benzene
Found 3 products.