
CAS 1204295-58-8
:1-(Difluorophenylmethyl)-2-fluorobenzene
Description:
1-(Difluorophenylmethyl)-2-fluorobenzene, identified by its CAS number 1204295-58-8, is an organic compound characterized by its unique molecular structure, which includes a difluorophenyl group and a fluorobenzene moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity due to the presence of multiple fluorine substituents. The fluorine atoms contribute to its lipophilicity and can influence its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The presence of fluorine can enhance the compound's metabolic stability and alter its interaction with biological targets. Additionally, the compound's melting and boiling points, solubility, and reactivity would be influenced by the arrangement of the fluorine atoms and the overall molecular geometry. As with many fluorinated compounds, it may also exhibit unique environmental behavior and toxicity profiles, necessitating careful handling and assessment in practical applications.
Formula:C13H9F3
InChI:InChI=1S/C13H9F3/c14-12-9-5-4-8-11(12)13(15,16)10-6-2-1-3-7-10/h1-9H
InChI key:InChIKey=JFBWULYHHFERPA-UHFFFAOYSA-N
SMILES:C(F)(F)(C1=C(F)C=CC=C1)C2=CC=CC=C2
Synonyms:- Benzene, 1-(difluorophenylmethyl)-2-fluoro-
- 1-(Difluorophenylmethyl)-2-fluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.