CAS 1204295-70-4

Pyridine, 2,2′-(difluoromethylene)bis-

Description:

Pyridine, 2,2′-(difluoromethylene)bis- is a chemical compound characterized by its pyridine rings and a difluoromethylene bridge connecting them. Pyridine itself is a six-membered aromatic heterocycle containing one nitrogen atom, which contributes to its basicity and reactivity. The presence of the difluoromethylene group introduces significant electronegativity due to the fluorine atoms, influencing the compound's chemical behavior, stability, and potential reactivity. This compound may exhibit properties typical of both pyridine derivatives and difluoromethylene compounds, such as increased lipophilicity and altered electronic characteristics. It is likely to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the specific conditions. Additionally, the compound's structure may impart unique biological activities, making it of interest in medicinal chemistry and material science. As with many fluorinated compounds, it may also exhibit enhanced thermal and chemical stability. Safety and handling precautions should be observed due to potential toxicity and environmental impact associated with fluorinated organic compounds.

Formula: C₁₁H₈F₂N₂

InChI: InChI=1S/C11H8F2N2/c12-11(13,9-5-1-3-7-14-9)10-6-2-4-8-15-10/h1-8H

InChI key: InChIKey=XPAVCQLTPWEBHR-UHFFFAOYSA-N

SMILES: C(F)(F)(C1=CC=CC=N1)C2=CC=CC=N2

Synonyms:

• 2-(Difluoro-pyridin-2-ylmethyl)pyridine
• Difluorodipyridin-2-ylmethane
• Pyridine, 2,2′-(difluoromethylene)bis-