
CAS 1204295-97-5
:1-(1,1-Difluoroethyl)naphthalene
Description:
1-(1,1-Difluoroethyl)naphthalene is an organic compound characterized by the presence of a naphthalene ring substituted with a 1,1-difluoroethyl group. This compound features a polycyclic aromatic structure, which contributes to its stability and hydrophobic nature. The difluoroethyl substituent introduces fluorine atoms, which can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points. Typically, compounds like this may exhibit low solubility in water but higher solubility in organic solvents. The presence of fluorine can also impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and analysis. Safety data should be consulted to understand any potential hazards associated with handling this substance, as fluorinated compounds can sometimes pose environmental and health risks.
Formula:C12H10F2
InChI:InChI=1S/C12H10F2/c1-12(13,14)11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3
InChI key:InChIKey=SDLMGLBMWMEGFQ-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- Naphthalene, 1-(1,1-difluoroethyl)-
- 1-(1,1-Difluoroethyl)naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.