
CAS 1204296-01-4
:1-(2-Chloro-1,1-difluoroethyl)-2,4-difluorobenzene
Description:
1-(2-Chloro-1,1-difluoroethyl)-2,4-difluorobenzene is a chemical compound characterized by its unique structure, which includes a difluoroethyl group and a difluorobenzene moiety. This compound features a chlorine atom and two fluorine atoms attached to the ethyl group, contributing to its reactivity and potential applications in various chemical processes. The presence of multiple fluorine atoms typically enhances the compound's stability and lipophilicity, making it of interest in fields such as agrochemicals and pharmaceuticals. The chlorinated and fluorinated nature of the compound may also impart specific properties, such as increased resistance to degradation and altered solubility profiles. Additionally, the compound's molecular structure suggests potential for interactions with biological systems, which could be relevant for its use in medicinal chemistry. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling or utilizing this substance in research or industrial applications.
Formula:C8H5ClF4
InChI:InChI=1S/C8H5ClF4/c9-4-8(12,13)6-2-1-5(10)3-7(6)11/h1-3H,4H2
InChI key:InChIKey=NEVMZNJHAIBJAL-UHFFFAOYSA-N
SMILES:C(CCl)(F)(F)C1=C(F)C=C(F)C=C1
Synonyms:- 1-(2-Chloro-1,1-difluoroethyl)-2,4-difluorobenzene
- Benzene, 1-(2-chloro-1,1-difluoroethyl)-2,4-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.