CymitQuimica logo

CAS 1204296-06-9

:

(Cyclopropyldifluoromethyl)benzene

Description:
(Cyclopropyldifluoromethyl)benzene, identified by its CAS number 1204296-06-9, is an organic compound characterized by the presence of a cyclopropyl group and a difluoromethyl group attached to a benzene ring. This compound exhibits unique chemical properties due to the strain in the cyclopropyl ring and the electronegative fluorine atoms, which can influence its reactivity and stability. The difluoromethyl group is known for its ability to enhance lipophilicity and can affect the compound's interactions in biological systems. The presence of both cyclopropyl and difluoromethyl functionalities may impart interesting characteristics, such as potential applications in pharmaceuticals or agrochemicals, where modifications to the aromatic system can lead to altered biological activity. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the overall molecular structure and the presence of these functional groups. Overall, (Cyclopropyldifluoromethyl)benzene represents a class of compounds with potential utility in various chemical applications.
Formula:C10H10F2
InChI:InChI=1S/C10H10F2/c11-10(12,9-6-7-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChI key:InChIKey=IODBYEJURXZPLZ-UHFFFAOYSA-N
SMILES:C(F)(F)(C1CC1)C2=CC=CC=C2
Synonyms:
  • (Cyclopropyldifluoromethyl)benzene
  • Benzene, (cyclopropyldifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.