
CAS 1204296-10-5
:1-Chloro-4-(cyclopropyldifluoromethyl)benzene
Description:
1-Chloro-4-(cyclopropyldifluoromethyl)benzene is an organic compound characterized by its aromatic structure, featuring a chlorobenzene core with a cyclopropyldifluoromethyl substituent at the para position. The presence of the chlorine atom introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The cyclopropyldifluoromethyl group adds steric hindrance and unique electronic properties due to the difluoromethyl moiety, which can enhance the compound's lipophilicity and potentially its biological activity. This compound is likely to exhibit moderate stability under standard conditions but may undergo reactions typical of aromatic halides, such as nucleophilic substitution or electrophilic aromatic substitution. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, where specific interactions with biological targets are desired. Safety and handling considerations should be taken into account due to the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C10H9ClF2
InChI:InChI=1S/C10H9ClF2/c11-9-5-3-8(4-6-9)10(12,13)7-1-2-7/h3-7H,1-2H2
InChI key:InChIKey=BQKJRSBRKWJRJF-UHFFFAOYSA-N
SMILES:C(F)(F)(C1=CC=C(Cl)C=C1)C2CC2
Synonyms:- 1-Chloro-4-(cyclopropyldifluoromethyl)benzene
- Benzene, 1-chloro-4-(cyclopropyldifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.