CAS 1204296-33-2
:4-(1,2,4-Triazolo[4,3-b]pyridazin-6-yl)benzenamine
Description:
4-(1,2,4-Triazolo[4,3-b]pyridazin-6-yl)benzenamine is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyridazine moiety. This compound typically exhibits properties such as moderate to high solubility in polar solvents, which is common for many nitrogen-containing heterocycles. It may display biological activity, potentially acting as a pharmacophore in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of both amine and aromatic groups suggests that it could participate in hydrogen bonding and π-π stacking interactions, influencing its reactivity and binding affinity in biological systems. Additionally, the compound's stability and reactivity can be affected by the electronic properties of the substituents on the aromatic ring and the heterocyclic system. Overall, this compound's unique structural features make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H9N5
InChI:InChI=1S/C11H9N5/c12-9-3-1-8(2-4-9)10-5-6-11-14-13-7-16(11)15-10/h1-7H,12H2
InChI key:InChIKey=ZHCNCLMBCNJQOC-UHFFFAOYSA-N
SMILES:NC1=CC=C(C2=NN3C(C=C2)=NN=C3)C=C1
Synonyms:- 4-(1,2,4-Triazolo[4,3-b]pyridazin-6-yl)benzenamine
- Benzenamine, 4-(1,2,4-triazolo[4,3-b]pyridazin-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.